C8H10O2S — CID 15506622
(1R,4S)-2-methylsulfonylbicyclo[2.2.1]hepta-2,5-diene (PubChem CID 15506622) has the molecular formula C8H10O2S and a molecular weight of 170.23 g/mol. Its IUPAC name is (1R,4S)-2-methylsulfonylbicyclo[2.2.1]hepta-2,5-diene.
| Compound Name | (1R,4S)-2-methylsulfonylbicyclo[2.2.1]hepta-2,5-diene |
|---|---|
| PubChem CID | 15506622 |
| Molecular Formula | C8H10O2S |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (1R,4S)-2-methylsulfonylbicyclo[2.2.1]hepta-2,5-diene |
| SMILES | CS(=O)(=O)C1=C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C8H10O2S/c1-11(9,10)8-5-6-2-3-7(8)4-6/h2-3,5-7H,4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | AZKZGXQDBFEJIT-RQJHMYQMSA-N |
| XLogP | 1.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|