C10H8F3NO — CID 21024140
4,4,4-trifluoro-2-hydroxy-2-phenylbutanenitrile (PubChem CID 21024140) has the molecular formula C10H8F3NO and a molecular weight of 215.17 g/mol. Its IUPAC name is 4,4,4-trifluoro-2-hydroxy-2-phenylbutanenitrile.
| Compound Name | 4,4,4-trifluoro-2-hydroxy-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 21024140 |
| Molecular Formula | C10H8F3NO |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 4,4,4-trifluoro-2-hydroxy-2-phenylbutanenitrile |
| SMILES | N#CC(O)(CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H8F3NO/c11-10(12,13)6-9(15,7-14)8-4-2-1-3-5-8/h1-5,15H,6H2 |
| InChIKey | VZXIAYDLNPWKQM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|