C34H21Li2N9O6S3 — CID 21024670
dilithium;6-[[4-cyano-5-[(2,6-dianilino-5-cyano-4-methyl-3-pyridinyl)diazenyl]thiophen-2-yl]diazenyl]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate (PubChem CID 21024670) has the molecular formula C34H21Li2N9O6S3 and a molecular weight of 761.68 g/mol. Its IUPAC name is dilithium;6-[[4-cyano-5-[(2,6-dianilino-5-cyano-4-methyl-3-pyridinyl)diazenyl]thiophen-2-yl]diazenyl]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate.
| Compound Name | dilithium;6-[[4-cyano-5-[(2,6-dianilino-5-cyano-4-methyl-3-pyridinyl)diazenyl]thiophen-2-yl]diazenyl]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 21024670 |
| Molecular Formula | C34H21Li2N9O6S3 |
| Molecular Weight | 761.68 g/mol |
| Exact Mass | 761.11 |
| IUPAC Name | dilithium;6-[[4-cyano-5-[(2,6-dianilino-5-cyano-4-methyl-3-pyridinyl)diazenyl]thiophen-2-yl]diazenyl]-3-oxidoperoxysulfanylnaphthalene-1-sulfonate |
| SMILES | Cc1c(C#N)c(Nc2ccccc2)nc(Nc2ccccc2)c1/N=N/c1sc(/N=N/c2ccc3c(S(=O)(=O)[O-])cc(SOO[O-])cc3c2)cc1C#N.[Li+].[Li+] |
| InChI | InChI=1S/C34H23N9O6S3.2Li/c1-20-28(19-36)32(37-23-8-4-2-5-9-23)39-33(38-24-10-6-3-7-11-24)31(20)42-43-34-22(18-35)16-30(50-34)41-40-25-12-13-27-21(14-25)15-26(51-49-48-44)17-29(27)52(45,46)47;;/h2-17,44H,1H3,(H2,37,38,39)(H,45,46,47);;/q;2*+1/p-2/b41-40+,43-42+;; |
| InChIKey | IRWHTAICARSALI-HARMDXJISA-L |
| XLogP | 2.81 |
| TPSA | 232.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|