C46H54N8S — CID 161076558
2,6-dianilino-5-[[5-[(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)diazenyl]-3,4-dimethylthiophen-2-yl]diazenyl]-4-methylpyridine-3-carbonitrile;ethane (PubChem CID 161076558) has the molecular formula C46H54N8S and a molecular weight of 751.06 g/mol. Its IUPAC name is 2,6-dianilino-5-[[5-[(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)diazenyl]-3,4-dimethylthiophen-2-yl]diazenyl]-4-methylpyridine-3-carbonitrile;ethane.
| Compound Name | 2,6-dianilino-5-[[5-[(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)diazenyl]-3,4-dimethylthiophen-2-yl]diazenyl]-4-methylpyridine-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 161076558 |
| Molecular Formula | C46H54N8S |
| Molecular Weight | 751.06 g/mol |
| Exact Mass | 750.42 |
| IUPAC Name | 2,6-dianilino-5-[[5-[(1,3,4,5,6,7,8-heptamethylnaphthalen-2-yl)diazenyl]-3,4-dimethylthiophen-2-yl]diazenyl]-4-methylpyridine-3-carbonitrile;ethane |
| SMILES | CC.CC.Cc1c(/N=N/c2c(Nc3ccccc3)nc(Nc3ccccc3)c(C#N)c2C)sc(/N=N/c2c(C)c(C)c3c(C)c(C)c(C)c(C)c3c2C)c1C |
| InChI | InChI=1S/C42H42N8S.2C2H6/c1-22-23(2)25(4)36-31(10)37(27(6)26(5)35(36)24(22)3)47-49-41-28(7)29(8)42(51-41)50-48-38-30(9)34(21-43)39(44-32-17-13-11-14-18-32)46-40(38)45-33-19-15-12-16-20-33;2*1-2/h11-20H,1-10H3,(H2,44,45,46);2*1-2H3/b49-47+,50-48+;; |
| InChIKey | UFIWJJAKOGOUCH-GOMIHYJDSA-N |
| XLogP | 15.62 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.06 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|