C23H31N3O4S2 — CID 21026565
N-hydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-(2-methylpropyl)-2-(2-thiophen-2-ylsulfanylethyl)propanediamide (PubChem CID 21026565) has the molecular formula C23H31N3O4S2 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-hydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-(2-methylpropyl)-2-(2-thiophen-2-ylsulfanylethyl)propanediamide.
| Compound Name | N-hydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-(2-methylpropyl)-2-(2-thiophen-2-ylsulfanylethyl)propanediamide |
|---|---|
| PubChem CID | 21026565 |
| Molecular Formula | C23H31N3O4S2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-hydroxy-N'-[1-(methylamino)-1-oxo-3-phenylpropan-2-yl]-2-(2-methylpropyl)-2-(2-thiophen-2-ylsulfanylethyl)propanediamide |
| SMILES | CNC(=O)C(Cc1ccccc1)NC(=O)C(CCSc1cccs1)(CC(C)C)C(=O)NO |
| InChI | InChI=1S/C23H31N3O4S2/c1-16(2)15-23(22(29)26-30,11-13-32-19-10-7-12-31-19)21(28)25-18(20(27)24-3)14-17-8-5-4-6-9-17/h4-10,12,16,18,30H,11,13-15H2,1-3H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | QKBBCSLYMZPVMT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|