C20H31N3O6 — CID 59873538
(2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)butanediamide (PubChem CID 59873538) has the molecular formula C20H31N3O6 and a molecular weight of 409.48 g/mol. Its IUPAC name is (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)butanediamide.
| Compound Name | (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 59873538 |
| Molecular Formula | C20H31N3O6 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)[C@](O)(CC(C)C)[C@H](C)C(=O)NO |
| InChI | InChI=1S/C20H31N3O6/c1-12(2)11-20(27,13(3)17(24)23-28)19(26)22-16(18(25)21-4)10-14-6-8-15(29-5)9-7-14/h6-9,12-13,16,27-28H,10-11H2,1-5H3,(H,21,25)(H,22,26)(H,23,24)/t13-,16+,20+/m1/s1 |
| InChIKey | AKOUBNOPSOYPDV-PSGMQZRDSA-N |
| XLogP | 0.39 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|