C19H26N2O5 — CID 70364342
(E)-3-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhex-2-enoic acid (PubChem CID 70364342) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is (E)-3-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhex-2-enoic acid.
| Compound Name | (E)-3-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhex-2-enoic acid |
|---|---|
| PubChem CID | 70364342 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (E)-3-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-5-methylhex-2-enoic acid |
| SMILES | CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)/C(=C/C(=O)O)CC(C)C |
| InChI | InChI=1S/C19H26N2O5/c1-12(2)9-14(11-17(22)23)18(24)21-16(19(25)20-3)10-13-5-7-15(26-4)8-6-13/h5-8,11-12,16H,9-10H2,1-4H3,(H,20,25)(H,21,24)(H,22,23)/b14-11+/t16-/m0/s1 |
| InChIKey | IKYOLBKALANBOF-UKYUDJEDSA-N |
| XLogP | 1.53 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|