C19H29N3O6 — CID 59873545
(2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-propan-2-ylbutanediamide (PubChem CID 59873545) has the molecular formula C19H29N3O6 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-propan-2-ylbutanediamide.
| Compound Name | (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-propan-2-ylbutanediamide |
|---|---|
| PubChem CID | 59873545 |
| Molecular Formula | C19H29N3O6 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (2S,3S)-N',2-dihydroxy-N-[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]-3-methyl-2-propan-2-ylbutanediamide |
| SMILES | CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)[C@](O)(C(C)C)[C@H](C)C(=O)NO |
| InChI | InChI=1S/C19H29N3O6/c1-11(2)19(26,12(3)16(23)22-27)18(25)21-15(17(24)20-4)10-13-6-8-14(28-5)9-7-13/h6-9,11-12,15,26-27H,10H2,1-5H3,(H,20,24)(H,21,25)(H,22,23)/t12-,15+,19+/m1/s1 |
| InChIKey | SSNOXSWRPUYSSL-YFROIQMUSA-N |
| XLogP | -0.00 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|