C26H41N3O6S — CID 22843660
(2S)-2-[[4-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-6-methylheptanoyl]amino]-4-methyl-3-sulfanylpentanoic acid (PubChem CID 22843660) has the molecular formula C26H41N3O6S and a molecular weight of 523.70 g/mol. Its IUPAC name is (2S)-2-[[4-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-6-methylheptanoyl]amino]-4-methyl-3-sulfanylpentanoic acid.
| Compound Name | (2S)-2-[[4-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-6-methylheptanoyl]amino]-4-methyl-3-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 22843660 |
| Molecular Formula | C26H41N3O6S |
| Molecular Weight | 523.70 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | (2S)-2-[[4-[[(2S)-3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-6-methylheptanoyl]amino]-4-methyl-3-sulfanylpentanoic acid |
| SMILES | CNC(=O)[C@H](Cc1ccc(OC)cc1)NC(=O)C(CCC(=O)N[C@@H](C(=O)O)C(S)C(C)C)CC(C)C |
| InChI | InChI=1S/C26H41N3O6S/c1-15(2)13-18(9-12-21(30)29-22(26(33)34)23(36)16(3)4)24(31)28-20(25(32)27-5)14-17-7-10-19(35-6)11-8-17/h7-8,10-11,15-16,18,20,22-23,36H,9,12-14H2,1-6H3,(H,27,32)(H,28,31)(H,29,30)(H,33,34)/t18?,20-,22+,23?/m0/s1 |
| InChIKey | NXKWJBJZOISOFR-OXDUUTLMSA-N |
| XLogP | 2.43 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|