C33H38N3O7P — CID 70290859
[4-(1,3-dioxoisoindol-2-yl)phenyl]methyl-[2-[[3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methylpentyl]phosphinic acid (PubChem CID 70290859) has the molecular formula C33H38N3O7P and a molecular weight of 619.66 g/mol. Its IUPAC name is [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl-[2-[[3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methylpentyl]phosphinic acid.
| Compound Name | [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl-[2-[[3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methylpentyl]phosphinic acid |
|---|---|
| PubChem CID | 70290859 |
| Molecular Formula | C33H38N3O7P |
| Molecular Weight | 619.66 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | [4-(1,3-dioxoisoindol-2-yl)phenyl]methyl-[2-[[3-(4-methoxyphenyl)-1-(methylamino)-1-oxopropan-2-yl]carbamoyl]-4-methylpentyl]phosphinic acid |
| SMILES | CNC(=O)C(Cc1ccc(OC)cc1)NC(=O)C(CC(C)C)CP(=O)(O)Cc1ccc(N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C33H38N3O7P/c1-21(2)17-24(30(37)35-29(31(38)34-3)18-22-11-15-26(43-4)16-12-22)20-44(41,42)19-23-9-13-25(14-10-23)36-32(39)27-7-5-6-8-28(27)33(36)40/h5-16,21,24,29H,17-20H2,1-4H3,(H,34,38)(H,35,37)(H,41,42) |
| InChIKey | PANDHPLNSAENJU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.66 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|