C19H27Cl2N3O5 — CID 22946234
N-[3-(2,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide (PubChem CID 22946234) has the molecular formula C19H27Cl2N3O5 and a molecular weight of 448.35 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide.
| Compound Name | N-[3-(2,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 22946234 |
| Molecular Formula | C19H27Cl2N3O5 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[3-(2,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)C(Cc1ccc(Cl)cc1Cl)NC(=O)C(O)(CC(C)C)C(C)C(=O)NO |
| InChI | InChI=1S/C19H27Cl2N3O5/c1-10(2)9-19(28,11(3)16(25)24-29)18(27)23-15(17(26)22-4)7-12-5-6-13(20)8-14(12)21/h5-6,8,10-11,15,28-29H,7,9H2,1-4H3,(H,22,26)(H,23,27)(H,24,25) |
| InChIKey | RDFLFSYAGLZCQR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|