C22H33Cl2N3O7 — CID 22946238
N-[3-(3,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethylamino]-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide (PubChem CID 22946238) has the molecular formula C22H33Cl2N3O7 and a molecular weight of 522.43 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethylamino]-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethylamino]-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 22946238 |
| Molecular Formula | C22H33Cl2N3O7 |
| Molecular Weight | 522.43 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-1-[2-(2-hydroxyethoxy)ethylamino]-1-oxopropan-2-yl]-N',2-dihydroxy-3-methyl-2-(2-methylpropyl)butanediamide |
| SMILES | CC(C)CC(O)(C(=O)NC(Cc1ccc(Cl)c(Cl)c1)C(=O)NCCOCCO)C(C)C(=O)NO |
| InChI | InChI=1S/C22H33Cl2N3O7/c1-13(2)12-22(32,14(3)19(29)27-33)21(31)26-18(20(30)25-6-8-34-9-7-28)11-15-4-5-16(23)17(24)10-15/h4-5,10,13-14,18,28,32-33H,6-9,11-12H2,1-3H3,(H,25,30)(H,26,31)(H,27,29) |
| InChIKey | YFXLLSZRFWCEIN-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 157.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|