C23H18Cl2N4O2S2 — CID 2102706
(2R)-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide (PubChem CID 2102706) has the molecular formula C23H18Cl2N4O2S2 and a molecular weight of 517.46 g/mol. Its IUPAC name is (2R)-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide.
| Compound Name | (2R)-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 2102706 |
| Molecular Formula | C23H18Cl2N4O2S2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.02 |
| IUPAC Name | (2R)-N-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)Nc2nc(-c3ccc(Cl)c(Cl)c3)cs2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H18Cl2N4O2S2/c1-3-10-29-21(31)15-6-4-5-7-18(15)27-23(29)33-13(2)20(30)28-22-26-19(12-32-22)14-8-9-16(24)17(25)11-14/h3-9,11-13H,1,10H2,2H3,(H,26,28,30)/t13-/m1/s1 |
| InChIKey | FQTYEDIMGFXZJX-CYBMUJFWSA-N |
| XLogP | 6.13 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|