C9H18O3 — CID 21027154
3-[(E)-4-methylpent-2-enoxy]propane-1,2-diol (PubChem CID 21027154) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 3-[(E)-4-methylpent-2-enoxy]propane-1,2-diol.
| Compound Name | 3-[(E)-4-methylpent-2-enoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 21027154 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 3-[(E)-4-methylpent-2-enoxy]propane-1,2-diol |
| SMILES | CC(C)/C=C/COCC(O)CO |
| InChI | InChI=1S/C9H18O3/c1-8(2)4-3-5-12-7-9(11)6-10/h3-4,8-11H,5-7H2,1-2H3/b4-3+ |
| InChIKey | WDUDLCYSZRQRSU-ONEGZZNKSA-N |
| XLogP | 0.57 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|