C22H34 — CID 21029318
4,5,6,7-tetramethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 21029318) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 4,5,6,7-tetramethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 21029318 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 4,5,6,7-tetramethyl-1-(6-methylhept-5-en-2-yl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)=CCCC(C)C1CCC(C)c2c1cc(C)c(C)c2C |
| InChI | InChI=1S/C22H34/c1-14(2)9-8-10-15(3)20-12-11-16(4)22-19(7)18(6)17(5)13-21(20)22/h9,13,15-16,20H,8,10-12H2,1-7H3 |
| InChIKey | WXSQNGMBRBNXCI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|