C27H35NO3 — CID 70686230
(1S,4R)-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-5-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydronaphthalene (PubChem CID 70686230) has the molecular formula C27H35NO3 and a molecular weight of 421.58 g/mol. Its IUPAC name is (1S,4R)-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-5-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,4R)-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-5-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 70686230 |
| Molecular Formula | C27H35NO3 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (1S,4R)-4,7-dimethyl-1-[(2S)-6-methylhept-5-en-2-yl]-5-[(4-nitrophenyl)methoxy]-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1CC[C@@H](C)c2c(OCc3ccc([N+](=O)[O-])cc3)cc(C)cc21 |
| InChI | InChI=1S/C27H35NO3/c1-18(2)7-6-8-20(4)24-14-9-21(5)27-25(24)15-19(3)16-26(27)31-17-22-10-12-23(13-11-22)28(29)30/h7,10-13,15-16,20-21,24H,6,8-9,14,17H2,1-5H3/t20-,21+,24-/m0/s1 |
| InChIKey | MCJZHNKLEBBXOH-IMSXRSKXSA-N |
| XLogP | 7.85 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|