C20H30O3 — CID 14466279
(5S,8R)-3,8-bis(hydroxymethyl)-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-ol (PubChem CID 14466279) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (5S,8R)-3,8-bis(hydroxymethyl)-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-ol.
| Compound Name | (5S,8R)-3,8-bis(hydroxymethyl)-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 14466279 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (5S,8R)-3,8-bis(hydroxymethyl)-5-[(2S)-6-methylhept-5-en-2-yl]-5,6,7,8-tetrahydronaphthalen-1-ol |
| SMILES | CC(C)=CCC[C@H](C)[C@@H]1CC[C@@H](CO)c2c(O)cc(CO)cc21 |
| InChI | InChI=1S/C20H30O3/c1-13(2)5-4-6-14(3)17-8-7-16(12-22)20-18(17)9-15(11-21)10-19(20)23/h5,9-10,14,16-17,21-23H,4,6-8,11-12H2,1-3H3/t14-,16-,17-/m0/s1 |
| InChIKey | ZSZNWYCFYXPPSL-XIRDDKMYSA-N |
| XLogP | 4.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|