C24H32O6 — CID 162953180
4-acetyloxy-5-(acetyloxymethyl)-8-(6-methylhept-5-en-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 162953180) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is 4-acetyloxy-5-(acetyloxymethyl)-8-(6-methylhept-5-en-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 4-acetyloxy-5-(acetyloxymethyl)-8-(6-methylhept-5-en-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 162953180 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 4-acetyloxy-5-(acetyloxymethyl)-8-(6-methylhept-5-en-2-yl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | CC(=O)OCC1CCC(C(C)CCC=C(C)C)c2cc(C(=O)O)cc(OC(C)=O)c21 |
| InChI | InChI=1S/C24H32O6/c1-14(2)7-6-8-15(3)20-10-9-18(13-29-16(4)25)23-21(20)11-19(24(27)28)12-22(23)30-17(5)26/h7,11-12,15,18,20H,6,8-10,13H2,1-5H3,(H,27,28) |
| InChIKey | KUKYWGGLHCZNPB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|