C16H15F6N3 — CID 21029579
4-(4-methylpiperazin-1-yl)-2,6-bis(trifluoromethyl)quinoline (PubChem CID 21029579) has the molecular formula C16H15F6N3 and a molecular weight of 363.31 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-2,6-bis(trifluoromethyl)quinoline.
| Compound Name | 4-(4-methylpiperazin-1-yl)-2,6-bis(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 21029579 |
| Molecular Formula | C16H15F6N3 |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-2,6-bis(trifluoromethyl)quinoline |
| SMILES | CN1CCN(c2cc(C(F)(F)F)nc3ccc(C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C16H15F6N3/c1-24-4-6-25(7-5-24)13-9-14(16(20,21)22)23-12-3-2-10(8-11(12)13)15(17,18)19/h2-3,8-9H,4-7H2,1H3 |
| InChIKey | ULVKJJALEIZXHF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |