C17H30O4Si2 — CID 21030515
bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate (PubChem CID 21030515) has the molecular formula C17H30O4Si2 and a molecular weight of 354.60 g/mol. Its IUPAC name is bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate.
| Compound Name | bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 21030515 |
| Molecular Formula | C17H30O4Si2 |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | bis(trimethylsilyl) 3,5-bis(ethenyl)cyclopentane-1,2-dicarboxylate |
| SMILES | C=CC1CC(C=C)C(C(=O)O[Si](C)(C)C)C1C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H30O4Si2/c1-9-12-11-13(10-2)15(17(19)21-23(6,7)8)14(12)16(18)20-22(3,4)5/h9-10,12-15H,1-2,11H2,3-8H3 |
| InChIKey | RBPJHQJLBPJYBI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|