C12H24ClN — CID 21031542
2-(3-chloropropyl)-2,4,6,6-tetramethylpiperidine (PubChem CID 21031542) has the molecular formula C12H24ClN and a molecular weight of 217.78 g/mol. Its IUPAC name is 2-(3-chloropropyl)-2,4,6,6-tetramethylpiperidine.
| Compound Name | 2-(3-chloropropyl)-2,4,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 21031542 |
| Molecular Formula | C12H24ClN |
| Molecular Weight | 217.78 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 2-(3-chloropropyl)-2,4,6,6-tetramethylpiperidine |
| SMILES | CC1CC(C)(C)NC(C)(CCCCl)C1 |
| InChI | InChI=1S/C12H24ClN/c1-10-8-11(2,3)14-12(4,9-10)6-5-7-13/h10,14H,5-9H2,1-4H3 |
| InChIKey | VXKDLUQRYAUVNT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|