C16H13N5O2S — CID 2103166
N-(6-ethyl-1,3-benzothiazol-2-yl)-3-hydroxybenzotriazole-5-carboxamide (PubChem CID 2103166) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(6-ethyl-1,3-benzothiazol-2-yl)-3-hydroxybenzotriazole-5-carboxamide.
| Compound Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-3-hydroxybenzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 2103166 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(6-ethyl-1,3-benzothiazol-2-yl)-3-hydroxybenzotriazole-5-carboxamide |
| SMILES | CCc1ccc2nc(NC(=O)c3ccc4nnn(O)c4c3)sc2c1 |
| InChI | InChI=1S/C16H13N5O2S/c1-2-9-3-5-12-14(7-9)24-16(17-12)18-15(22)10-4-6-11-13(8-10)21(23)20-19-11/h3-8,23H,2H2,1H3,(H,17,18,22) |
| InChIKey | KVCWXVXNZJLWLR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|