C31H39NO7 — CID 21034898
ethyl N-(2,2-dimethoxyethyl)-N-[2-(3-ethoxyphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]carbamate (PubChem CID 21034898) has the molecular formula C31H39NO7 and a molecular weight of 537.65 g/mol. Its IUPAC name is ethyl N-(2,2-dimethoxyethyl)-N-[2-(3-ethoxyphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]carbamate.
| Compound Name | ethyl N-(2,2-dimethoxyethyl)-N-[2-(3-ethoxyphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 21034898 |
| Molecular Formula | C31H39NO7 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | ethyl N-(2,2-dimethoxyethyl)-N-[2-(3-ethoxyphenyl)-1-(3-methoxy-4-phenylmethoxyphenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N(CC(OC)OC)C(Cc1cccc(OCC)c1)c1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C31H39NO7/c1-6-37-26-15-11-14-24(18-26)19-27(32(31(33)38-7-2)21-30(35-4)36-5)25-16-17-28(29(20-25)34-3)39-22-23-12-9-8-10-13-23/h8-18,20,27,30H,6-7,19,21-22H2,1-5H3 |
| InChIKey | LYYRNWNVYIZJDS-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|