C28H33NO6 — CID 22048394
2,2-dimethoxyethyl-[1-(3-ethoxy-4-phenylmethoxyphenyl)-2-phenylethyl]carbamic acid (PubChem CID 22048394) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-[1-(3-ethoxy-4-phenylmethoxyphenyl)-2-phenylethyl]carbamic acid.
| Compound Name | 2,2-dimethoxyethyl-[1-(3-ethoxy-4-phenylmethoxyphenyl)-2-phenylethyl]carbamic acid |
|---|---|
| PubChem CID | 22048394 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 2,2-dimethoxyethyl-[1-(3-ethoxy-4-phenylmethoxyphenyl)-2-phenylethyl]carbamic acid |
| SMILES | CCOc1cc(C(Cc2ccccc2)N(CC(OC)OC)C(=O)O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H33NO6/c1-4-34-26-18-23(15-16-25(26)35-20-22-13-9-6-10-14-22)24(17-21-11-7-5-8-12-21)29(28(30)31)19-27(32-2)33-3/h5-16,18,24,27H,4,17,19-20H2,1-3H3,(H,30,31) |
| InChIKey | QJPNSIUZOVLKRU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|