C25H27NO7S2 — CID 21035273
N-[1-[4-[4-methoxy-2-(4-methoxyphenyl)sulfonylphenyl]sulfonylphenyl]ethyl]propanamide (PubChem CID 21035273) has the molecular formula C25H27NO7S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[1-[4-[4-methoxy-2-(4-methoxyphenyl)sulfonylphenyl]sulfonylphenyl]ethyl]propanamide.
| Compound Name | N-[1-[4-[4-methoxy-2-(4-methoxyphenyl)sulfonylphenyl]sulfonylphenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 21035273 |
| Molecular Formula | C25H27NO7S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | N-[1-[4-[4-methoxy-2-(4-methoxyphenyl)sulfonylphenyl]sulfonylphenyl]ethyl]propanamide |
| SMILES | CCC(=O)NC(C)c1ccc(S(=O)(=O)c2ccc(OC)cc2S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H27NO7S2/c1-5-25(27)26-17(2)18-6-11-21(12-7-18)34(28,29)23-15-10-20(33-4)16-24(23)35(30,31)22-13-8-19(32-3)9-14-22/h6-17H,5H2,1-4H3,(H,26,27) |
| InChIKey | FXCBZFWKYXJOSC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |