C28H26FNO5S2 — CID 21035279
N-benzyl-1-[4-[2-(2-fluorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]ethanamine (PubChem CID 21035279) has the molecular formula C28H26FNO5S2 and a molecular weight of 539.65 g/mol. Its IUPAC name is N-benzyl-1-[4-[2-(2-fluorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]ethanamine.
| Compound Name | N-benzyl-1-[4-[2-(2-fluorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]ethanamine |
|---|---|
| PubChem CID | 21035279 |
| Molecular Formula | C28H26FNO5S2 |
| Molecular Weight | 539.65 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | N-benzyl-1-[4-[2-(2-fluorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]ethanamine |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(C(C)NCc3ccccc3)cc2)c(S(=O)(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C28H26FNO5S2/c1-20(30-19-21-8-4-3-5-9-21)22-12-15-24(16-13-22)36(31,32)27-17-14-23(35-2)18-28(27)37(33,34)26-11-7-6-10-25(26)29/h3-18,20,30H,19H2,1-2H3 |
| InChIKey | CWPKJDIFROQHGU-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |