C20H18ClNO5S2 — CID 142805303
[4-[2-(4-chlorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]methanamine (PubChem CID 142805303) has the molecular formula C20H18ClNO5S2 and a molecular weight of 451.95 g/mol. Its IUPAC name is [4-[2-(4-chlorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]methanamine.
| Compound Name | [4-[2-(4-chlorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]methanamine |
|---|---|
| PubChem CID | 142805303 |
| Molecular Formula | C20H18ClNO5S2 |
| Molecular Weight | 451.95 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | [4-[2-(4-chlorophenyl)sulfonyl-4-methoxyphenyl]sulfonylphenyl]methanamine |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(CN)cc2)c(S(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H18ClNO5S2/c1-27-16-6-11-19(28(23,24)17-7-2-14(13-22)3-8-17)20(12-16)29(25,26)18-9-4-15(21)5-10-18/h2-12H,13,22H2,1H3 |
| InChIKey | NETXCXIVPGGQIP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |