C16H24 — CID 21035914
6-[(E)-3,3-dimethylpent-1-en-4-ynyl]-1,5,5-trimethylcyclohexene (PubChem CID 21035914) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is 6-[(E)-3,3-dimethylpent-1-en-4-ynyl]-1,5,5-trimethylcyclohexene.
| Compound Name | 6-[(E)-3,3-dimethylpent-1-en-4-ynyl]-1,5,5-trimethylcyclohexene |
|---|---|
| PubChem CID | 21035914 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 6-[(E)-3,3-dimethylpent-1-en-4-ynyl]-1,5,5-trimethylcyclohexene |
| SMILES | C#CC(C)(C)/C=C/C1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C16H24/c1-7-15(3,4)12-10-14-13(2)9-8-11-16(14,5)6/h1,9-10,12,14H,8,11H2,2-6H3/b12-10+ |
| InChIKey | BOJHCSKNXLOHHR-ZRDIBKRKSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|