C17H34N6O4 — CID 21036198
N-[2-(methylamino)propan-2-yl]-N'-[2-[[3-[2-(methylamino)propan-2-ylamino]-3-oxopropanoyl]amino]propan-2-yl]propanediamide (PubChem CID 21036198) has the molecular formula C17H34N6O4 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[2-(methylamino)propan-2-yl]-N'-[2-[[3-[2-(methylamino)propan-2-ylamino]-3-oxopropanoyl]amino]propan-2-yl]propanediamide.
| Compound Name | N-[2-(methylamino)propan-2-yl]-N'-[2-[[3-[2-(methylamino)propan-2-ylamino]-3-oxopropanoyl]amino]propan-2-yl]propanediamide |
|---|---|
| PubChem CID | 21036198 |
| Molecular Formula | C17H34N6O4 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | N-[2-(methylamino)propan-2-yl]-N'-[2-[[3-[2-(methylamino)propan-2-ylamino]-3-oxopropanoyl]amino]propan-2-yl]propanediamide |
| SMILES | CNC(C)(C)NC(=O)CC(=O)NC(C)(C)NC(=O)CC(=O)NC(C)(C)NC |
| InChI | InChI=1S/C17H34N6O4/c1-15(2,18-7)20-11(24)9-13(26)22-17(5,6)23-14(27)10-12(25)21-16(3,4)19-8/h18-19H,9-10H2,1-8H3,(H,20,24)(H,21,25)(H,22,26)(H,23,27) |
| InChIKey | ZWXJUWQCXCXFBM-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 140.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|