C8H16N4O5 — CID 58721399
N'-[acetamido(dihydroxy)methyl]-N-(methylaminomethyl)propanediamide (PubChem CID 58721399) has the molecular formula C8H16N4O5 and a molecular weight of 248.24 g/mol. Its IUPAC name is N'-[acetamido(dihydroxy)methyl]-N-(methylaminomethyl)propanediamide.
| Compound Name | N'-[acetamido(dihydroxy)methyl]-N-(methylaminomethyl)propanediamide |
|---|---|
| PubChem CID | 58721399 |
| Molecular Formula | C8H16N4O5 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N'-[acetamido(dihydroxy)methyl]-N-(methylaminomethyl)propanediamide |
| SMILES | CNCNC(=O)CC(=O)NC(O)(O)NC(C)=O |
| InChI | InChI=1S/C8H16N4O5/c1-5(13)11-8(16,17)12-7(15)3-6(14)10-4-9-2/h9,16-17H,3-4H2,1-2H3,(H,10,14)(H,11,13)(H,12,15) |
| InChIKey | RNZSUBUSHWDWRG-UHFFFAOYSA-N |
| XLogP | -3.48 |
| TPSA | 139.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|