C19H32N6O14 — CID 161437062
N-[dihydroxy(methylamino)methyl]-N'-[dihydroxy-(3-oxobutanoylamino)methyl]propanediamide;N-[dihydroxy-(3-oxobutanoylamino)methyl]-3-oxobutanamide (PubChem CID 161437062) has the molecular formula C19H32N6O14 and a molecular weight of 568.49 g/mol. Its IUPAC name is N-[dihydroxy(methylamino)methyl]-N'-[dihydroxy-(3-oxobutanoylamino)methyl]propanediamide;N-[dihydroxy-(3-oxobutanoylamino)methyl]-3-oxobutanamide.
| Compound Name | N-[dihydroxy(methylamino)methyl]-N'-[dihydroxy-(3-oxobutanoylamino)methyl]propanediamide;N-[dihydroxy-(3-oxobutanoylamino)methyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 161437062 |
| Molecular Formula | C19H32N6O14 |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | N-[dihydroxy(methylamino)methyl]-N'-[dihydroxy-(3-oxobutanoylamino)methyl]propanediamide;N-[dihydroxy-(3-oxobutanoylamino)methyl]-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC(O)(O)NC(=O)CC(C)=O.CNC(O)(O)NC(=O)CC(=O)NC(O)(O)NC(=O)CC(C)=O |
| InChI | InChI=1S/C10H18N4O8.C9H14N2O6/c1-5(15)3-6(16)13-10(21,22)14-8(18)4-7(17)12-9(19,20)11-2;1-5(12)3-7(14)10-9(16,17)11-8(15)4-6(2)13/h11,19-22H,3-4H2,1-2H3,(H,12,17)(H,13,16)(H,14,18);16-17H,3-4H2,1-2H3,(H,10,14)(H,11,15) |
| InChIKey | VYUAWKSSFKAPBF-UHFFFAOYSA-N |
| XLogP | -7.11 |
| TPSA | 330.12 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | -7.11 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|