C19H19NO2 — CID 2104010
2,3,5-trimethyl-6-(quinolin-2-ylmethyl)benzene-1,4-diol (PubChem CID 2104010) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2,3,5-trimethyl-6-(quinolin-2-ylmethyl)benzene-1,4-diol.
| Compound Name | 2,3,5-trimethyl-6-(quinolin-2-ylmethyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 2104010 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2,3,5-trimethyl-6-(quinolin-2-ylmethyl)benzene-1,4-diol |
| SMILES | Cc1c(C)c(O)c(Cc2ccc3ccccc3n2)c(C)c1O |
| InChI | InChI=1S/C19H19NO2/c1-11-12(2)19(22)16(13(3)18(11)21)10-15-9-8-14-6-4-5-7-17(14)20-15/h4-9,21-22H,10H2,1-3H3 |
| InChIKey | DPUDNBLCRWZWGW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|