C37H28F6N2OS4 — CID 21044731
4-ethyl-5-[2-[4-ethyl-2-[4-(4-methoxyphenyl)phenyl]-1,3-thiazol-5-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-1,3-thiazole (PubChem CID 21044731) has the molecular formula C37H28F6N2OS4 and a molecular weight of 758.90 g/mol. Its IUPAC name is 4-ethyl-5-[2-[4-ethyl-2-[4-(4-methoxyphenyl)phenyl]-1,3-thiazol-5-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-1,3-thiazole.
| Compound Name | 4-ethyl-5-[2-[4-ethyl-2-[4-(4-methoxyphenyl)phenyl]-1,3-thiazol-5-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 21044731 |
| Molecular Formula | C37H28F6N2OS4 |
| Molecular Weight | 758.90 g/mol |
| Exact Mass | 758.10 |
| IUPAC Name | 4-ethyl-5-[2-[4-ethyl-2-[4-(4-methoxyphenyl)phenyl]-1,3-thiazol-5-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-[5-(5-methylthiophen-2-yl)thiophen-2-yl]-1,3-thiazole |
| SMILES | CCc1nc(-c2ccc(-c3ccc(OC)cc3)cc2)sc1C1=C(c2sc(-c3ccc(-c4ccc(C)s4)s3)nc2CC)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C37H28F6N2OS4/c1-5-24-31(49-33(44-24)22-10-8-20(9-11-22)21-12-14-23(46-4)15-13-21)29-30(36(40,41)37(42,43)35(29,38)39)32-25(6-2)45-34(50-32)28-18-17-27(48-28)26-16-7-19(3)47-26/h7-18H,5-6H2,1-4H3 |
| InChIKey | AWNCAIFCDPYAIR-UHFFFAOYSA-N |
| XLogP | 12.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.90 |
| LogP ≤ 5 | 12.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|