C25H18F6N2OS3 — CID 21044736
5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole (PubChem CID 21044736) has the molecular formula C25H18F6N2OS3 and a molecular weight of 572.62 g/mol. Its IUPAC name is 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole.
| Compound Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 21044736 |
| Molecular Formula | C25H18F6N2OS3 |
| Molecular Weight | 572.62 g/mol |
| Exact Mass | 572.05 |
| IUPAC Name | 5-[3,3,4,4,5,5-hexafluoro-2-[2-(4-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]cyclopenten-1-yl]-4-methyl-2-(5-methylthiophen-2-yl)-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(C)c(C3=C(c4sc(-c5ccc(C)s5)nc4C)C(F)(F)C(F)(F)C3(F)F)s2)cc1 |
| InChI | InChI=1S/C25H18F6N2OS3/c1-11-5-10-16(35-11)22-33-13(3)20(37-22)18-17(23(26,27)25(30,31)24(18,28)29)19-12(2)32-21(36-19)14-6-8-15(34-4)9-7-14/h5-10H,1-4H3 |
| InChIKey | RDPQFGUNPPEHAJ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.62 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|