C21H12F6N2S2 — CID 21044740
2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[2,3-b]pyridin-2-yl)cyclopenten-1-yl]-3-methylthieno[2,3-b]pyridine (PubChem CID 21044740) has the molecular formula C21H12F6N2S2 and a molecular weight of 470.46 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[2,3-b]pyridin-2-yl)cyclopenten-1-yl]-3-methylthieno[2,3-b]pyridine.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[2,3-b]pyridin-2-yl)cyclopenten-1-yl]-3-methylthieno[2,3-b]pyridine |
|---|---|
| PubChem CID | 21044740 |
| Molecular Formula | C21H12F6N2S2 |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 470.03 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methylthieno[2,3-b]pyridin-2-yl)cyclopenten-1-yl]-3-methylthieno[2,3-b]pyridine |
| SMILES | Cc1c(C2=C(c3sc4ncccc4c3C)C(F)(F)C(F)(F)C2(F)F)sc2ncccc12 |
| InChI | InChI=1S/C21H12F6N2S2/c1-9-11-5-3-7-28-17(11)30-15(9)13-14(20(24,25)21(26,27)19(13,22)23)16-10(2)12-6-4-8-29-18(12)31-16/h3-8H,1-2H3 |
| InChIKey | LPORQWSMHJGIGQ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|