C30H31NO3S — CID 21046176
5-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 21046176) has the molecular formula C30H31NO3S and a molecular weight of 485.65 g/mol. Its IUPAC name is 5-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 21046176 |
| Molecular Formula | C30H31NO3S |
| Molecular Weight | 485.65 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 5-(5-tert-butyl-2-methylphenyl)sulfanyl-N-[2-(2-phenoxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1Sc1ccc(C(=O)NCCc2ccccc2Oc2ccccc2)o1 |
| InChI | InChI=1S/C30H31NO3S/c1-21-14-15-23(30(2,3)4)20-27(21)35-28-17-16-26(34-28)29(32)31-19-18-22-10-8-9-13-25(22)33-24-11-6-5-7-12-24/h5-17,20H,18-19H2,1-4H3,(H,31,32) |
| InChIKey | AGABRNZXZRXSEH-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.65 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |