C8H20N2O5S2 — CID 21049568
3-(diethylamino)propylsulfamoylmethanesulfonic acid (PubChem CID 21049568) has the molecular formula C8H20N2O5S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(diethylamino)propylsulfamoylmethanesulfonic acid.
| Compound Name | 3-(diethylamino)propylsulfamoylmethanesulfonic acid |
|---|---|
| PubChem CID | 21049568 |
| Molecular Formula | C8H20N2O5S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 3-(diethylamino)propylsulfamoylmethanesulfonic acid |
| SMILES | CCN(CC)CCCNS(=O)(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C8H20N2O5S2/c1-3-10(4-2)7-5-6-9-16(11,12)8-17(13,14)15/h9H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | QIRFBNGKMAJDHG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|