C11H25N3O12S4 — CID 19930380
[5-(disulfomethyl)-1,5,9-triazacyclododec-1-yl]methanedisulfonic acid (PubChem CID 19930380) has the molecular formula C11H25N3O12S4 and a molecular weight of 519.60 g/mol. Its IUPAC name is [5-(disulfomethyl)-1,5,9-triazacyclododec-1-yl]methanedisulfonic acid.
| Compound Name | [5-(disulfomethyl)-1,5,9-triazacyclododec-1-yl]methanedisulfonic acid |
|---|---|
| PubChem CID | 19930380 |
| Molecular Formula | C11H25N3O12S4 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | [5-(disulfomethyl)-1,5,9-triazacyclododec-1-yl]methanedisulfonic acid |
| SMILES | O=S(=O)(O)C(N1CCCNCCCN(C(S(=O)(=O)O)S(=O)(=O)O)CCC1)S(=O)(=O)O |
| InChI | InChI=1S/C11H25N3O12S4/c15-27(16,17)10(28(18,19)20)13-6-1-4-12-5-2-7-14(9-3-8-13)11(29(21,22)23)30(24,25)26/h10-12H,1-9H2,(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26) |
| InChIKey | ZFZQLDWTFOJKEW-UHFFFAOYSA-N |
| XLogP | -2.52 |
| TPSA | 235.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | -2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|