C8H21N3O24S8 — CID 18417942
[2-[2-[bis(disulfomethyl)amino]ethylamino]ethyl-(disulfomethyl)amino]methanedisulfonic acid (PubChem CID 18417942) has the molecular formula C8H21N3O24S8 and a molecular weight of 799.79 g/mol. Its IUPAC name is [2-[2-[bis(disulfomethyl)amino]ethylamino]ethyl-(disulfomethyl)amino]methanedisulfonic acid.
| Compound Name | [2-[2-[bis(disulfomethyl)amino]ethylamino]ethyl-(disulfomethyl)amino]methanedisulfonic acid |
|---|---|
| PubChem CID | 18417942 |
| Molecular Formula | C8H21N3O24S8 |
| Molecular Weight | 799.79 g/mol |
| Exact Mass | 798.83 |
| IUPAC Name | [2-[2-[bis(disulfomethyl)amino]ethylamino]ethyl-(disulfomethyl)amino]methanedisulfonic acid |
| SMILES | O=S(=O)(O)C(N(CCNCCN(C(S(=O)(=O)O)S(=O)(=O)O)C(S(=O)(=O)O)S(=O)(=O)O)C(S(=O)(=O)O)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C8H21N3O24S8/c12-36(13,14)5(37(15,16)17)10(6(38(18,19)20)39(21,22)23)3-1-9-2-4-11(7(40(24,25)26)41(27,28)29)8(42(30,31)32)43(33,34)35/h5-9H,1-4H2,(H,12,13,14)(H,15,16,17)(H,18,19,20)(H,21,22,23)(H,24,25,26)(H,27,28,29)(H,30,31,32)(H,33,34,35) |
| InChIKey | OPVGSPXPEMDVJN-UHFFFAOYSA-N |
| XLogP | -6.58 |
| TPSA | 453.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.79 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|