C6H16N2O5S2 — CID 20665353
3-(dimethylamino)propylsulfamoylmethanesulfonic acid (PubChem CID 20665353) has the molecular formula C6H16N2O5S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 3-(dimethylamino)propylsulfamoylmethanesulfonic acid.
| Compound Name | 3-(dimethylamino)propylsulfamoylmethanesulfonic acid |
|---|---|
| PubChem CID | 20665353 |
| Molecular Formula | C6H16N2O5S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 3-(dimethylamino)propylsulfamoylmethanesulfonic acid |
| SMILES | CN(C)CCCNS(=O)(=O)CS(=O)(=O)O |
| InChI | InChI=1S/C6H16N2O5S2/c1-8(2)5-3-4-7-14(9,10)6-15(11,12)13/h7H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | HIVXJALCLOGLFN-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|