C15H36N4O4S2 — CID 58113233
N,N'-bis[3-(diethylamino)propyl]methanedisulfonamide (PubChem CID 58113233) has the molecular formula C15H36N4O4S2 and a molecular weight of 400.61 g/mol. Its IUPAC name is N,N'-bis[3-(diethylamino)propyl]methanedisulfonamide.
| Compound Name | N,N'-bis[3-(diethylamino)propyl]methanedisulfonamide |
|---|---|
| PubChem CID | 58113233 |
| Molecular Formula | C15H36N4O4S2 |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N,N'-bis[3-(diethylamino)propyl]methanedisulfonamide |
| SMILES | CCN(CC)CCCNS(=O)(=O)CS(=O)(=O)NCCCN(CC)CC |
| InChI | InChI=1S/C15H36N4O4S2/c1-5-18(6-2)13-9-11-16-24(20,21)15-25(22,23)17-12-10-14-19(7-3)8-4/h16-17H,5-15H2,1-4H3 |
| InChIKey | SOEJXYHDWRNAJJ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|