C23H52N4O4S2 — CID 58113246
N,N'-bis[3-(dibutylamino)propyl]methanedisulfonamide (PubChem CID 58113246) has the molecular formula C23H52N4O4S2 and a molecular weight of 512.83 g/mol. Its IUPAC name is N,N'-bis[3-(dibutylamino)propyl]methanedisulfonamide.
| Compound Name | N,N'-bis[3-(dibutylamino)propyl]methanedisulfonamide |
|---|---|
| PubChem CID | 58113246 |
| Molecular Formula | C23H52N4O4S2 |
| Molecular Weight | 512.83 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | N,N'-bis[3-(dibutylamino)propyl]methanedisulfonamide |
| SMILES | CCCCN(CCCC)CCCNS(=O)(=O)CS(=O)(=O)NCCCN(CCCC)CCCC |
| InChI | InChI=1S/C23H52N4O4S2/c1-5-9-17-26(18-10-6-2)21-13-15-24-32(28,29)23-33(30,31)25-16-14-22-27(19-11-7-3)20-12-8-4/h24-25H,5-23H2,1-4H3 |
| InChIKey | CSWVCFLPQIVIMX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|