C16H37N3O6S3 — CID 129091851
N-[3-(diethylsulfamoyl)butyl]-N-methyl-4-(propan-2-ylsulfonylamino)butane-2-sulfonamide (PubChem CID 129091851) has the molecular formula C16H37N3O6S3 and a molecular weight of 463.69 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)butyl]-N-methyl-4-(propan-2-ylsulfonylamino)butane-2-sulfonamide.
| Compound Name | N-[3-(diethylsulfamoyl)butyl]-N-methyl-4-(propan-2-ylsulfonylamino)butane-2-sulfonamide |
|---|---|
| PubChem CID | 129091851 |
| Molecular Formula | C16H37N3O6S3 |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | N-[3-(diethylsulfamoyl)butyl]-N-methyl-4-(propan-2-ylsulfonylamino)butane-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C(C)CCN(C)S(=O)(=O)C(C)CCNS(=O)(=O)C(C)C |
| InChI | InChI=1S/C16H37N3O6S3/c1-8-19(9-2)28(24,25)16(6)11-13-18(7)27(22,23)15(5)10-12-17-26(20,21)14(3)4/h14-17H,8-13H2,1-7H3 |
| InChIKey | ZWSDOHQENKHCGB-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 120.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |