C16H42N6O9S4 — CID 91437527
1-(dimethylamino)-3-[3-(dimethylamino)propylsulfamoylsulfonylamino]propane;3-(dimethylamino)propylsulfamoylmethanesulfonic acid (PubChem CID 91437527) has the molecular formula C16H42N6O9S4 and a molecular weight of 590.81 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[3-(dimethylamino)propylsulfamoylsulfonylamino]propane;3-(dimethylamino)propylsulfamoylmethanesulfonic acid.
| Compound Name | 1-(dimethylamino)-3-[3-(dimethylamino)propylsulfamoylsulfonylamino]propane;3-(dimethylamino)propylsulfamoylmethanesulfonic acid |
|---|---|
| PubChem CID | 91437527 |
| Molecular Formula | C16H42N6O9S4 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 1-(dimethylamino)-3-[3-(dimethylamino)propylsulfamoylsulfonylamino]propane;3-(dimethylamino)propylsulfamoylmethanesulfonic acid |
| SMILES | CN(C)CCCNS(=O)(=O)CS(=O)(=O)O.CN(C)CCCNS(=O)(=O)S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C10H26N4O4S2.C6H16N2O5S2/c1-13(2)9-5-7-11-19(15,16)20(17,18)12-8-6-10-14(3)4;1-8(2)5-3-4-7-14(9,10)6-15(11,12)13/h11-12H,5-10H2,1-4H3;7H,3-6H2,1-2H3,(H,11,12,13) |
| InChIKey | GBUIPPRFVZRJRS-UHFFFAOYSA-N |
| XLogP | -2.65 |
| TPSA | 202.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|