C10H24N2O8S3 — CID 58792545
3-[3-(methanesulfonamido)propyl-(3-sulfopropyl)amino]propane-1-sulfonic acid (PubChem CID 58792545) has the molecular formula C10H24N2O8S3 and a molecular weight of 396.51 g/mol. Its IUPAC name is 3-[3-(methanesulfonamido)propyl-(3-sulfopropyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[3-(methanesulfonamido)propyl-(3-sulfopropyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58792545 |
| Molecular Formula | C10H24N2O8S3 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 3-[3-(methanesulfonamido)propyl-(3-sulfopropyl)amino]propane-1-sulfonic acid |
| SMILES | CS(=O)(=O)NCCCN(CCCS(=O)(=O)O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C10H24N2O8S3/c1-21(13,14)11-5-2-6-12(7-3-9-22(15,16)17)8-4-10-23(18,19)20/h11H,2-10H2,1H3,(H,15,16,17)(H,18,19,20) |
| InChIKey | GLOQHRNZZQHDMA-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|