C18H26N2O4S2 — CID 21056284
4-tert-butyl-2-[cyclohexylsulfonyl(diazo)methyl]sulfonyl-1-methylbenzene (PubChem CID 21056284) has the molecular formula C18H26N2O4S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 4-tert-butyl-2-[cyclohexylsulfonyl(diazo)methyl]sulfonyl-1-methylbenzene.
| Compound Name | 4-tert-butyl-2-[cyclohexylsulfonyl(diazo)methyl]sulfonyl-1-methylbenzene |
|---|---|
| PubChem CID | 21056284 |
| Molecular Formula | C18H26N2O4S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-tert-butyl-2-[cyclohexylsulfonyl(diazo)methyl]sulfonyl-1-methylbenzene |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)C(=[N+]=[N-])S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H26N2O4S2/c1-13-10-11-14(18(2,3)4)12-16(13)26(23,24)17(20-19)25(21,22)15-8-6-5-7-9-15/h10-12,15H,5-9H2,1-4H3 |
| InChIKey | AIKWGYPUWNZXFG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|