C34H38F2N2O4 — CID 21058664
dimethyl 2,5-bis(N-cyclohexyl-2-fluoroanilino)benzene-1,4-dicarboxylate (PubChem CID 21058664) has the molecular formula C34H38F2N2O4 and a molecular weight of 576.68 g/mol. Its IUPAC name is dimethyl 2,5-bis(N-cyclohexyl-2-fluoroanilino)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2,5-bis(N-cyclohexyl-2-fluoroanilino)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 21058664 |
| Molecular Formula | C34H38F2N2O4 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | dimethyl 2,5-bis(N-cyclohexyl-2-fluoroanilino)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1cc(N(c2ccccc2F)C2CCCCC2)c(C(=O)OC)cc1N(c1ccccc1F)C1CCCCC1 |
| InChI | InChI=1S/C34H38F2N2O4/c1-41-33(39)25-21-32(38(24-15-7-4-8-16-24)30-20-12-10-18-28(30)36)26(34(40)42-2)22-31(25)37(23-13-5-3-6-14-23)29-19-11-9-17-27(29)35/h9-12,17-24H,3-8,13-16H2,1-2H3 |
| InChIKey | ZOKXQSVRIMVGBA-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |