C18H18N4OS — CID 2105993
1-[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 2105993) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 1-[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 2105993 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 1-[4-(6-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ncnc3sc(-c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C18H18N4OS/c1-13(23)21-7-9-22(10-8-21)17-15-11-16(14-5-3-2-4-6-14)24-18(15)20-12-19-17/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | OTILGEOHPLURFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |