About methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate
methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate (PubChem CID 21063015) has the molecular formula C15H17NO4
and a molecular weight of 275.30 g/mol. Its IUPAC name is methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate |
| PubChem CID | 21063015 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate |
| SMILES | COC(=O)CC1CCc2cc(NC(C)=O)ccc2C1=O |
| InChI | InChI=1S/C15H17NO4/c1-9(17)16-12-5-6-13-10(7-12)3-4-11(15(13)19)8-14(18)20-2/h5-7,11H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | XFVJFPAQOCZADH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate?
The IUPAC name of methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate (CID 21063015) is methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate.
What is the SMILES notation for methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate?
The canonical SMILES for methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate is COC(=O)CC1CCc2cc(NC(C)=O)ccc2C1=O.
What is the InChIKey of methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate?
The InChIKey is XFVJFPAQOCZADH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO4/c1-9(17)16-12-5-6-13-10(7-12)3-4-11(15(13)19)8-14(18)20-2/h5-7,11H,3-4,8H2,1-2H3,(H,16,17).
What are the key properties of methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate?
methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate has a molecular weight of 275.30 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-acetamido-1-oxo-3,4-dihydro-2H-naphthalen-2-yl)acetate is sourced from PubChem (CID 21063015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).