C19H28N4O3 — CID 21064625
methyl 3,3-dimethyl-4-[3-[5-(pyridin-2-ylamino)pentyl]-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 21064625) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is methyl 3,3-dimethyl-4-[3-[5-(pyridin-2-ylamino)pentyl]-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | methyl 3,3-dimethyl-4-[3-[5-(pyridin-2-ylamino)pentyl]-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 21064625 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | methyl 3,3-dimethyl-4-[3-[5-(pyridin-2-ylamino)pentyl]-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | COC(=O)CC(C)(C)Cc1nc(CCCCCNc2ccccn2)no1 |
| InChI | InChI=1S/C19H28N4O3/c1-19(2,14-18(24)25-3)13-17-22-16(23-26-17)10-5-4-7-11-20-15-9-6-8-12-21-15/h6,8-9,12H,4-5,7,10-11,13-14H2,1-3H3,(H,20,21) |
| InChIKey | IRCHJULCYPBDKL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|